C21H20N2O3 — CID 95795069
[2-[[(1S)-1-(4-methylphenyl)ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 95795069) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-methylphenyl)ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[[(1S)-1-(4-methylphenyl)ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 95795069 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [2-[[(1S)-1-(4-methylphenyl)ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | Cc1ccc([C@H](C)NC(=O)COC(=O)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-7-9-16(10-8-14)15(2)22-20(24)13-26-21(25)19-12-11-17-5-3-4-6-18(17)23-19/h3-12,15H,13H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | DNIBAXPYIIICED-HNNXBMFYSA-N |
| XLogP | 3.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |