C24H24N2O3 — CID 55326250
[2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 55326250) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 55326250 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CCc1ccc(C(C)NC(=O)COC(=O)/C=C/c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-3-18-8-10-19(11-9-18)17(2)25-23(27)16-29-24(28)15-14-21-13-12-20-6-4-5-7-22(20)26-21/h4-15,17H,3,16H2,1-2H3,(H,25,27)/b15-14+ |
| InChIKey | ANPPGNGLELESJS-CCEZHUSRSA-N |
| XLogP | 4.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|