C21H26N2O3 — CID 8848437
[2-[[(2R)-5-methylhexan-2-yl]amino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 8848437) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-[[(2R)-5-methylhexan-2-yl]amino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-[[(2R)-5-methylhexan-2-yl]amino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8848437 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [2-[[(2R)-5-methylhexan-2-yl]amino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CC(C)CC[C@@H](C)NC(=O)COC(=O)/C=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H26N2O3/c1-15(2)8-9-16(3)22-20(24)14-26-21(25)13-12-18-11-10-17-6-4-5-7-19(17)23-18/h4-7,10-13,15-16H,8-9,14H2,1-3H3,(H,22,24)/b13-12+/t16-/m1/s1 |
| InChIKey | DBHPUHFSIVGURF-CJTWTEFWSA-N |
| XLogP | 3.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|