C26H27N3O3 — CID 18273436
[2-oxo-2-[4-(1-phenylethyl)piperazin-1-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 18273436) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-oxo-2-[4-(1-phenylethyl)piperazin-1-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-[4-(1-phenylethyl)piperazin-1-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 18273436 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [2-oxo-2-[4-(1-phenylethyl)piperazin-1-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)COC(=O)/C=C/c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H27N3O3/c1-20(21-7-3-2-4-8-21)28-15-17-29(18-16-28)25(30)19-32-26(31)14-13-23-12-11-22-9-5-6-10-24(22)27-23/h2-14,20H,15-19H2,1H3/b14-13+ |
| InChIKey | AJFFLFAQHCUHBA-BUHFOSPRSA-N |
| XLogP | 3.70 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|