C24H28N2O3 — CID 8008166
[2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 8008166) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is [2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8008166 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | [2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2C(=O)COC(=O)/C=C/c2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C24H28N2O3/c1-23(2)12-19-13-24(3,15-23)16-26(19)21(27)14-29-22(28)11-10-18-9-8-17-6-4-5-7-20(17)25-18/h4-11,19H,12-16H2,1-3H3/b11-10+/t19-,24-/m0/s1 |
| InChIKey | ULOHUJBNLLKFIM-WVNUFQETSA-N |
| XLogP | 4.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|