C19H24BrNO4 — CID 75585795
[2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 75585795) has the molecular formula C19H24BrNO4 and a molecular weight of 410.31 g/mol. Its IUPAC name is [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75585795 |
| Molecular Formula | C19H24BrNO4 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)COC(=O)C=Cc2ccc(Br)o2)C1 |
| InChI | InChI=1S/C19H24BrNO4/c1-18(2)8-13-9-19(3,11-18)12-21(13)16(22)10-24-17(23)7-5-14-4-6-15(20)25-14/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | LTHVRPXLDVEYAF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|