C28H42N2O6 — CID 25389743
1-O-[2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-O-[2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-but-2-enedioate (PubChem CID 25389743) has the molecular formula C28H42N2O6 and a molecular weight of 502.65 g/mol. Its IUPAC name is 1-O-[2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-O-[2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-[2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-O-[2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 25389743 |
| Molecular Formula | C28H42N2O6 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 1-O-[2-oxo-2-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-O-[2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] (E)-but-2-enedioate |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2C(=O)COC(=O)/C=C/C(=O)OCC(=O)N2C[C@@]3(C)C[C@@H]2CC(C)(C)C3)C1 |
| InChI | InChI=1S/C28H42N2O6/c1-25(2)9-19-11-27(5,15-25)17-29(19)21(31)13-35-23(33)7-8-24(34)36-14-22(32)30-18-28(6)12-20(30)10-26(3,4)16-28/h7-8,19-20H,9-18H2,1-6H3/b8-7+/t19-,20+,27-,28+ |
| InChIKey | PFUCFTQFWULNLR-AQKUASNQSA-N |
| XLogP | 3.48 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|