C27H29NO3 — CID 7749841
[2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 4-phenylbenzoate (PubChem CID 7749841) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 4-phenylbenzoate.
| Compound Name | [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 7749841 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 4-phenylbenzoate |
| SMILES | CC(C)Cc1ccc([C@H](C)NC(=O)COC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-19(2)17-21-9-11-22(12-10-21)20(3)28-26(29)18-31-27(30)25-15-13-24(14-16-25)23-7-5-4-6-8-23/h4-16,19-20H,17-18H2,1-3H3,(H,28,29)/t20-/m0/s1 |
| InChIKey | AGQYJNRWXAUVIN-FQEVSTJZSA-N |
| XLogP | 5.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |