C23H25N3O3 — CID 7677460
[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoxaline-6-carboxylate (PubChem CID 7677460) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoxaline-6-carboxylate.
| Compound Name | [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 7677460 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoxaline-6-carboxylate |
| SMILES | CC(C)Cc1ccc([C@@H](C)NC(=O)COC(=O)c2ccc3nccnc3c2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-15(2)12-17-4-6-18(7-5-17)16(3)26-22(27)14-29-23(28)19-8-9-20-21(13-19)25-11-10-24-20/h4-11,13,15-16H,12,14H2,1-3H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | VTJYCYWEXFRLPB-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |