C12H14N2O6S — CID 7724769
[2-(methylcarbamoylamino)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 7724769) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7724769 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H14N2O6S/c1-13-12(17)14-10(15)7-20-11(16)8-5-3-4-6-9(8)21(2,18)19/h3-6H,7H2,1-2H3,(H2,13,14,15,17) |
| InChIKey | JDMWFUXNXXYQRG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |