C16H13F2NO5S — CID 18127503
[2-(3,5-difluoroanilino)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 18127503) has the molecular formula C16H13F2NO5S and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-(3,5-difluoroanilino)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18127503 |
| Molecular Formula | C16H13F2NO5S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13F2NO5S/c1-25(22,23)14-5-3-2-4-13(14)16(21)24-9-15(20)19-12-7-10(17)6-11(18)8-12/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | AUEMKPRIHZXDJU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |