C21H19NO5S — CID 8854981
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8854981) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8854981 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19NO5S/c1-2-28(25,26)19-10-6-5-9-18(19)21(24)27-14-20(23)22-17-12-11-15-7-3-4-8-16(15)13-17/h3-13H,2,14H2,1H3,(H,22,23) |
| InChIKey | YDWQCDNPGJZMJU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |