C19H21NO6S — CID 8855243
[2-(2-ethoxyanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8855243) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8855243 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1ccccc1S(=O)(=O)CC |
| InChI | InChI=1S/C19H21NO6S/c1-3-25-16-11-7-6-10-15(16)20-18(21)13-26-19(22)14-9-5-8-12-17(14)27(23,24)4-2/h5-12H,3-4,13H2,1-2H3,(H,20,21) |
| InChIKey | JGGAGFUINYFHRS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |