C19H19NO7S — CID 8855380
[2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8855380) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8855380 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H19NO7S/c1-3-28(24,25)16-7-5-4-6-15(16)19(23)27-12-17(21)20-14-10-8-13(9-11-14)18(22)26-2/h4-11H,3,12H2,1-2H3,(H,20,21) |
| InChIKey | RUQQNAYPVQZNLP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |