C19H19NO5S — CID 8658348
[2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate (PubChem CID 8658348) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658348 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)OCC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-3-26-16-7-5-4-6-15(16)19(23)25-12-17(21)20-14-10-8-13(9-11-14)18(22)24-2/h4-11H,3,12H2,1-2H3,(H,20,21) |
| InChIKey | XPHLRKRAJONDSB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |