C17H16N2O5S — CID 8765544
[2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 8765544) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8765544 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)c2cccnc2SC)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-16(21)11-5-7-12(8-6-11)19-14(20)10-24-17(22)13-4-3-9-18-15(13)25-2/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | COMTUMSDGIWQOH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |