C15H12BrFN2O3S — CID 2572697
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 2572697) has the molecular formula C15H12BrFN2O3S and a molecular weight of 399.24 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2572697 |
| Molecular Formula | C15H12BrFN2O3S |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OCC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H12BrFN2O3S/c1-23-14-10(3-2-6-18-14)15(21)22-8-13(20)19-12-5-4-9(16)7-11(12)17/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | WUNFTCXOQSQLDF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |