C12H15N3O4S — CID 9344004
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 9344004) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 9344004 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CNC(=O)CNC(=O)COC(=O)c1cccnc1SC |
| InChI | InChI=1S/C12H15N3O4S/c1-13-9(16)6-15-10(17)7-19-12(18)8-4-3-5-14-11(8)20-2/h3-5H,6-7H2,1-2H3,(H,13,16)(H,15,17) |
| InChIKey | CWMMKXALVKQWCU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |