C20H22N2O4S — CID 8658714
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-ethylsulfanylbenzoate (PubChem CID 8658714) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-ethylsulfanylbenzoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658714 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)OCC(=O)Nc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-4-27-17-8-6-5-7-16(17)20(25)26-13-18(23)21-15-11-9-14(10-12-15)19(24)22(2)3/h5-12H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | DXDQJYBJOLDJQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |