C18H19NO3S2 — CID 8658386
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate (PubChem CID 8658386) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658386 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)OCC(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C18H19NO3S2/c1-3-24-15-10-6-4-8-13(15)18(21)22-12-17(20)19-14-9-5-7-11-16(14)23-2/h4-11H,3,12H2,1-2H3,(H,19,20) |
| InChIKey | IOFBLGRCJCDKKE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |