C16H14INO4S — CID 23991848
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate (PubChem CID 23991848) has the molecular formula C16H14INO4S and a molecular weight of 443.26 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
|---|---|
| PubChem CID | 23991848 |
| Molecular Formula | C16H14INO4S |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C16H14INO4S/c1-23-14-5-3-2-4-12(14)18-15(20)9-22-16(21)11-8-10(17)6-7-13(11)19/h2-8,19H,9H2,1H3,(H,18,20) |
| InChIKey | HSFUMQIYRAOYNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|