C27H27NO6S — CID 29320674
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(3,4-diethoxybenzoyl)benzoate (PubChem CID 29320674) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(3,4-diethoxybenzoyl)benzoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(3,4-diethoxybenzoyl)benzoate |
|---|---|
| PubChem CID | 29320674 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(3,4-diethoxybenzoyl)benzoate |
| SMILES | CCOc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)Nc2ccccc2SC)cc1OCC |
| InChI | InChI=1S/C27H27NO6S/c1-4-32-22-15-14-18(16-23(22)33-5-2)26(30)19-10-6-7-11-20(19)27(31)34-17-25(29)28-21-12-8-9-13-24(21)35-3/h6-16H,4-5,17H2,1-3H3,(H,28,29) |
| InChIKey | CFNZLSJIBBMGEO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |