C20H22N2O5S — CID 8024516
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 8024516) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8024516 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OCC(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C20H22N2O5S/c1-3-26-16-10-6-4-8-14(16)20(25)21-12-19(24)27-13-18(23)22-15-9-5-7-11-17(15)28-2/h4-11H,3,12-13H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | PQAXDYUHWGLHQQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |