C15H19N3O6 — CID 2547953
[2-(methylcarbamoylamino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 2547953) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2547953 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OCC(=O)NC(=O)NC |
| InChI | InChI=1S/C15H19N3O6/c1-3-23-11-7-5-4-6-10(11)14(21)17-8-13(20)24-9-12(19)18-15(22)16-2/h4-7H,3,8-9H2,1-2H3,(H,17,21)(H2,16,18,19,22) |
| InChIKey | PAKVORWIGXIOSM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |