C25H31NO6 — CID 16544390
[2-oxo-2-(pentan-2-ylamino)ethyl] 2-(3,4-diethoxybenzoyl)benzoate (PubChem CID 16544390) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(3,4-diethoxybenzoyl)benzoate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(3,4-diethoxybenzoyl)benzoate |
|---|---|
| PubChem CID | 16544390 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(3,4-diethoxybenzoyl)benzoate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1ccccc1C(=O)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C25H31NO6/c1-5-10-17(4)26-23(27)16-32-25(29)20-12-9-8-11-19(20)24(28)18-13-14-21(30-6-2)22(15-18)31-7-3/h8-9,11-15,17H,5-7,10,16H2,1-4H3,(H,26,27) |
| InChIKey | LOQRXIKMQYFTBJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |