C16H13Cl2NO3S — CID 7863056
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 7863056) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7863056 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO3S/c1-23-14-5-3-2-4-13(14)19-15(20)9-22-16(21)11-7-6-10(17)8-12(11)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | CSGBEGJSRXGLCD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |