C21H15Cl2NO3S — CID 4854500
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 2-chlorobenzoate (PubChem CID 4854500) has the molecular formula C21H15Cl2NO3S and a molecular weight of 432.33 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 2-chlorobenzoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4854500 |
| Molecular Formula | C21H15Cl2NO3S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15Cl2NO3S/c22-14-9-11-15(12-10-14)28-19-8-4-3-7-18(19)24-20(25)13-27-21(26)16-5-1-2-6-17(16)23/h1-12H,13H2,(H,24,25) |
| InChIKey | JECBSNUELAHIJD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |