C22H17ClN2O5S — CID 2441428
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-methyl-4-nitrobenzoate (PubChem CID 2441428) has the molecular formula C22H17ClN2O5S and a molecular weight of 456.91 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 2441428 |
| Molecular Formula | C22H17ClN2O5S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccccc2Sc2ccc(Cl)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17ClN2O5S/c1-14-12-15(6-11-19(14)25(28)29)22(27)30-13-21(26)24-18-4-2-3-5-20(18)31-17-9-7-16(23)8-10-17/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | DUZVRNQRLNPNIL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|