About [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate (PubChem CID 7860058) has the molecular formula C21H16ClNO3S
and a molecular weight of 397.88 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate |
| PubChem CID | 7860058 |
| Molecular Formula | C21H16ClNO3S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C21H16ClNO3S/c22-16-8-6-7-15(13-16)21(25)26-14-20(24)23-18-11-4-5-12-19(18)27-17-9-2-1-3-10-17/h1-13H,14H2,(H,23,24) |
| InChIKey | SAMHFDGXDNNARW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate?
The IUPAC name of [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate (CID 7860058) is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate.
What is the SMILES notation for [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate?
The canonical SMILES for [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate is O=C(COC(=O)c1cccc(Cl)c1)Nc1ccccc1Sc1ccccc1.
What is the InChIKey of [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate?
The InChIKey is SAMHFDGXDNNARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClNO3S/c22-16-8-6-7-15(13-16)21(25)26-14-20(24)23-18-11-4-5-12-19(18)27-17-9-2-1-3-10-17/h1-13H,14H2,(H,23,24).
What are the key properties of [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate?
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate has a molecular weight of 397.88 g/mol, XLogP of 5.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-chlorobenzoate is sourced from PubChem (CID 7860058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).