C24H22ClNO3S — CID 2401077
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 2401077) has the molecular formula C24H22ClNO3S and a molecular weight of 439.96 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 2401077 |
| Molecular Formula | C24H22ClNO3S |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)Nc1ccccc1Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO3S/c1-2-20(17-8-4-3-5-9-17)24(28)29-16-23(27)26-21-10-6-7-11-22(21)30-19-14-12-18(25)13-15-19/h3-15,20H,2,16H2,1H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | XZPKJZRTYYDGKF-FQEVSTJZSA-N |
| XLogP | 6.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |