C20H21NO4 — CID 3676896
[2-(2-acetylanilino)-2-oxoethyl] 2-phenylbutanoate (PubChem CID 3676896) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 2-phenylbutanoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 3676896 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCC(=O)Nc1ccccc1C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-3-16(15-9-5-4-6-10-15)20(24)25-13-19(23)21-18-12-8-7-11-17(18)14(2)22/h4-12,16H,3,13H2,1-2H3,(H,21,23) |
| InChIKey | GMWPYJMAQFKQNG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |