C15H20N2O4 — CID 9230008
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 9230008) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 9230008 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)NCC(=O)NC)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-12(11-7-5-4-6-8-11)15(20)21-10-14(19)17-9-13(18)16-2/h4-8,12H,3,9-10H2,1-2H3,(H,16,18)(H,17,19)/t12-/m0/s1 |
| InChIKey | ATFMXYRFVLGWDG-LBPRGKRZSA-N |
| XLogP | 0.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |