C20H23NO3 — CID 7811561
[2-oxo-2-(2-phenylethylamino)ethyl] (2R)-2-phenylbutanoate (PubChem CID 7811561) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylethylamino)ethyl] (2R)-2-phenylbutanoate.
| Compound Name | [2-oxo-2-(2-phenylethylamino)ethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7811561 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [2-oxo-2-(2-phenylethylamino)ethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCC(=O)NCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO3/c1-2-18(17-11-7-4-8-12-17)20(23)24-15-19(22)21-14-13-16-9-5-3-6-10-16/h3-12,18H,2,13-15H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | FJYPGZKZSAHCDG-GOSISDBHSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |