C21H25NO3 — CID 46619032
[1-oxo-1-(2-phenylethylamino)propan-2-yl] 2-phenylbutanoate (PubChem CID 46619032) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylethylamino)propan-2-yl] 2-phenylbutanoate.
| Compound Name | [1-oxo-1-(2-phenylethylamino)propan-2-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 46619032 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [1-oxo-1-(2-phenylethylamino)propan-2-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC(C)C(=O)NCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-3-19(18-12-8-5-9-13-18)21(24)25-16(2)20(23)22-15-14-17-10-6-4-7-11-17/h4-13,16,19H,3,14-15H2,1-2H3,(H,22,23) |
| InChIKey | OPOZMBRKFCKZCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |