C25H19ClN2O5S — CID 2398327
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2398327) has the molecular formula C25H19ClN2O5S and a molecular weight of 494.96 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2398327 |
| Molecular Formula | C25H19ClN2O5S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](C(=O)OCC(=O)Nc1ccccc1Sc1ccc(Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H19ClN2O5S/c1-15(28-23(30)18-6-2-3-7-19(18)24(28)31)25(32)33-14-22(29)27-20-8-4-5-9-21(20)34-17-12-10-16(26)11-13-17/h2-13,15H,14H2,1H3,(H,27,29)/t15-/m1/s1 |
| InChIKey | ZZQWDWOZMFOADZ-OAHLLOKOSA-N |
| XLogP | 4.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|