C21H20N2O5 — CID 1182293
[2-(2,4-dimethylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1182293) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-(2,4-dimethylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2,4-dimethylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 1182293 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(2,4-dimethylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@@H](C)N2C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-12-8-9-17(13(2)10-12)22-18(24)11-28-21(27)14(3)23-19(25)15-6-4-5-7-16(15)20(23)26/h4-10,14H,11H2,1-3H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | LODYUKWPQLWEMN-CQSZACIVSA-N |
| XLogP | 2.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|