C20H15Cl2N3O7 — CID 55927377
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55927377) has the molecular formula C20H15Cl2N3O7 and a molecular weight of 480.26 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55927377 |
| Molecular Formula | C20H15Cl2N3O7 |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@H](C)N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15Cl2N3O7/c1-9-3-4-15(16(5-9)25(30)31)23-17(26)8-32-20(29)10(2)24-18(27)11-6-13(21)14(22)7-12(11)19(24)28/h3-7,10H,8H2,1-2H3,(H,23,26)/t10-/m0/s1 |
| InChIKey | FZRATHXCQMYUDT-JTQLQIEISA-N |
| XLogP | 3.38 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|