C18H18Cl2N2O5 — CID 8752316
[2-[[(1S)-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8752316) has the molecular formula C18H18Cl2N2O5 and a molecular weight of 413.26 g/mol. Its IUPAC name is [2-[[(1S)-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[[(1S)-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8752316 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [2-[[(1S)-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](NC(=O)COC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C1CC1 |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-8(10-3-4-10)21-15(23)7-27-18(26)9(2)22-16(24)11-5-13(19)14(20)6-12(11)17(22)25/h5-6,8-10H,3-4,7H2,1-2H3,(H,21,23)/t8-,9-/m0/s1 |
| InChIKey | XSPLBJAWWZUCQV-IUCAKERBSA-N |
| XLogP | 2.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|