C19H20Cl2N2O7S — CID 55927581
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55927581) has the molecular formula C19H20Cl2N2O7S and a molecular weight of 491.35 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55927581 |
| Molecular Formula | C19H20Cl2N2O7S |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCN(C(=O)COC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20Cl2N2O7S/c1-3-22(11-4-5-31(28,29)9-11)16(24)8-30-19(27)10(2)23-17(25)12-6-14(20)15(21)7-13(12)18(23)26/h6-7,10-11H,3-5,8-9H2,1-2H3/t10-,11?/m0/s1 |
| InChIKey | JFOFXXMTMHSNFX-VUWPPUDQSA-N |
| XLogP | 1.56 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|