C15H18ClNO5S — CID 55320016
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 55320016) has the molecular formula C15H18ClNO5S and a molecular weight of 359.83 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 55320016 |
| Molecular Formula | C15H18ClNO5S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18ClNO5S/c1-2-17(13-6-7-23(20,21)10-13)14(18)9-22-15(19)11-4-3-5-12(16)8-11/h3-5,8,13H,2,6-7,9-10H2,1H3 |
| InChIKey | MPIAGNBWAGJBOJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |