C15H16Cl3NO5S — CID 2578733
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 2578733) has the molecular formula C15H16Cl3NO5S and a molecular weight of 428.72 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2578733 |
| Molecular Formula | C15H16Cl3NO5S |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1c(Cl)ccc(Cl)c1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16Cl3NO5S/c1-2-19(9-5-6-25(22,23)8-9)12(20)7-24-15(21)13-10(16)3-4-11(17)14(13)18/h3-4,9H,2,5-8H2,1H3/t9-/m1/s1 |
| InChIKey | PRNZFRODDGIKLK-SECBINFHSA-N |
| XLogP | 2.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|