C14H16Cl2N2O5S — CID 24979818
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 24979818) has the molecular formula C14H16Cl2N2O5S and a molecular weight of 395.26 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 24979818 |
| Molecular Formula | C14H16Cl2N2O5S |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1nc(Cl)ccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16Cl2N2O5S/c1-2-18(9-5-6-24(21,22)8-9)12(19)7-23-14(20)13-10(15)3-4-11(16)17-13/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | BDZKCMWQBBPSTH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|