C12H12Cl2N2O5S — CID 24979806
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 24979806) has the molecular formula C12H12Cl2N2O5S and a molecular weight of 367.21 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 24979806 |
| Molecular Formula | C12H12Cl2N2O5S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1nc(Cl)ccc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12Cl2N2O5S/c13-8-1-2-9(14)16-11(8)12(18)21-5-10(17)15-7-3-4-22(19,20)6-7/h1-2,7H,3-6H2,(H,15,17) |
| InChIKey | VIMMJAQSVNOFLA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|