C13H14BrNO5S — CID 6601193
[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-bromobenzoate (PubChem CID 6601193) has the molecular formula C13H14BrNO5S and a molecular weight of 376.23 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-bromobenzoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 6601193 |
| Molecular Formula | C13H14BrNO5S |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-bromobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Br)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14BrNO5S/c14-11-4-2-1-3-10(11)13(17)20-7-12(16)15-9-5-6-21(18,19)8-9/h1-4,9H,5-8H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | ZWZKVEPFDVPEIX-VIFPVBQESA-N |
| XLogP | 0.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |