C20H18N2O5S — CID 7522572
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 7522572) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 7522572 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)OCC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H18N2O5S/c21-11-14-5-1-2-6-16(14)17-7-3-4-8-18(17)20(24)27-12-19(23)22-15-9-10-28(25,26)13-15/h1-8,15H,9-10,12-13H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | GTQSUXHQDNKBSN-OAHLLOKOSA-N |
| XLogP | 1.69 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |