C13H14N2O7S — CID 2646616
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 2646616) has the molecular formula C13H14N2O7S and a molecular weight of 342.33 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2646616 |
| Molecular Formula | C13H14N2O7S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14N2O7S/c16-12(14-10-5-6-23(20,21)8-10)7-22-13(17)9-1-3-11(4-2-9)15(18)19/h1-4,10H,5-8H2,(H,14,16)/t10-/m1/s1 |
| InChIKey | SUXHDKHDWALGDU-SNVBAGLBSA-N |
| XLogP | 0.05 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|