C13H13F2NO5S — CID 3983722
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,5-difluorobenzoate (PubChem CID 3983722) has the molecular formula C13H13F2NO5S and a molecular weight of 333.31 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,5-difluorobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 3983722 |
| Molecular Formula | C13H13F2NO5S |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)cc(F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13F2NO5S/c14-9-3-8(4-10(15)5-9)13(18)21-6-12(17)16-11-1-2-22(19,20)7-11/h3-5,11H,1-2,6-7H2,(H,16,17) |
| InChIKey | HQPQURBDVUSCHZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |