C19H27NO8S — CID 3326955
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 3326955) has the molecular formula C19H27NO8S and a molecular weight of 429.49 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 3326955 |
| Molecular Formula | C19H27NO8S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H27NO8S/c1-4-25-15-9-13(10-16(26-5-2)18(15)27-6-3)19(22)28-11-17(21)20-14-7-8-29(23,24)12-14/h9-10,14H,4-8,11-12H2,1-3H3,(H,20,21) |
| InChIKey | GRJNLWRVUMVWJH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |