C18H23NO7S — CID 55463103
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate (PubChem CID 55463103) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 55463103 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23NO7S/c1-4-5-12-8-13(9-15(24-2)17(12)25-3)18(21)26-10-16(20)19-14-6-7-27(22,23)11-14/h4,8-9,14H,1,5-7,10-11H2,2-3H3,(H,19,20) |
| InChIKey | OFWGQYUTVRGPGM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|