C22H24ClNO7 — CID 42087612
[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate (PubChem CID 42087612) has the molecular formula C22H24ClNO7 and a molecular weight of 449.89 g/mol. Its IUPAC name is [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate.
| Compound Name | [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 42087612 |
| Molecular Formula | C22H24ClNO7 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)OCC(=O)Nc2cc(OC)c(Cl)cc2OC)cc(OC)c1OC |
| InChI | InChI=1S/C22H24ClNO7/c1-6-7-13-8-14(9-19(29-4)21(13)30-5)22(26)31-12-20(25)24-16-11-17(27-2)15(23)10-18(16)28-3/h6,8-11H,1,7,12H2,2-5H3,(H,24,25) |
| InChIKey | XFAKVQYWWPIXRU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|